C14H17F2N3O2 — CID 60801397
N-(2-amino-2-oxoethyl)-2,5-difluoro-N-piperidin-3-ylbenzamide (PubChem CID 60801397) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.30 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,5-difluoro-N-piperidin-3-ylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,5-difluoro-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 60801397 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,5-difluoro-N-piperidin-3-ylbenzamide |
| SMILES | NC(=O)CN(C(=O)c1cc(F)ccc1F)C1CCCNC1 |
| InChI | InChI=1S/C14H17F2N3O2/c15-9-3-4-12(16)11(6-9)14(21)19(8-13(17)20)10-2-1-5-18-7-10/h3-4,6,10,18H,1-2,5,7-8H2,(H2,17,20) |
| InChIKey | BKNKWRRKOYSOSI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |