C13H15F2N3O2 — CID 60806689
N-(2-amino-2-oxoethyl)-2,5-difluoro-N-pyrrolidin-3-ylbenzamide (PubChem CID 60806689) has the molecular formula C13H15F2N3O2 and a molecular weight of 283.28 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,5-difluoro-N-pyrrolidin-3-ylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,5-difluoro-N-pyrrolidin-3-ylbenzamide |
|---|---|
| PubChem CID | 60806689 |
| Molecular Formula | C13H15F2N3O2 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,5-difluoro-N-pyrrolidin-3-ylbenzamide |
| SMILES | NC(=O)CN(C(=O)c1cc(F)ccc1F)C1CCNC1 |
| InChI | InChI=1S/C13H15F2N3O2/c14-8-1-2-11(15)10(5-8)13(20)18(7-12(16)19)9-3-4-17-6-9/h1-2,5,9,17H,3-4,6-7H2,(H2,16,19) |
| InChIKey | CZWRXOBDLZEBAF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |