C12H16N4O3 — CID 81445402
N-(2-amino-2-oxoethyl)-3-hydroxy-N-pyrrolidin-3-ylpyridine-4-carboxamide (PubChem CID 81445402) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-hydroxy-N-pyrrolidin-3-ylpyridine-4-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-hydroxy-N-pyrrolidin-3-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 81445402 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-hydroxy-N-pyrrolidin-3-ylpyridine-4-carboxamide |
| SMILES | NC(=O)CN(C(=O)c1ccncc1O)C1CCNC1 |
| InChI | InChI=1S/C12H16N4O3/c13-11(18)7-16(8-1-3-14-5-8)12(19)9-2-4-15-6-10(9)17/h2,4,6,8,14,17H,1,3,5,7H2,(H2,13,18) |
| InChIKey | QYJDEBJBUPXTCU-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |