C16H14ClFN2O — CID 115645755
N-[(4-chlorophenyl)methyl]-N-cyclopropyl-3-fluoropyridine-4-carboxamide (PubChem CID 115645755) has the molecular formula C16H14ClFN2O and a molecular weight of 304.75 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-cyclopropyl-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-cyclopropyl-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 115645755 |
| Molecular Formula | C16H14ClFN2O |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-cyclopropyl-3-fluoropyridine-4-carboxamide |
| SMILES | O=C(c1ccncc1F)N(Cc1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C16H14ClFN2O/c17-12-3-1-11(2-4-12)10-20(13-5-6-13)16(21)14-7-8-19-9-15(14)18/h1-4,7-9,13H,5-6,10H2 |
| InChIKey | JLEKYXIXHPELJY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |