C18H18N4OS — CID 47074872
N-cyclopropyl-1-methyl-3-pyridin-4-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide (PubChem CID 47074872) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is N-cyclopropyl-1-methyl-3-pyridin-4-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide.
| Compound Name | N-cyclopropyl-1-methyl-3-pyridin-4-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 47074872 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-cyclopropyl-1-methyl-3-pyridin-4-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N(Cc2cccs2)C2CC2)c(-c2ccncc2)n1 |
| InChI | InChI=1S/C18H18N4OS/c1-21-12-16(17(20-21)13-6-8-19-9-7-13)18(23)22(14-4-5-14)11-15-3-2-10-24-15/h2-3,6-10,12,14H,4-5,11H2,1H3 |
| InChIKey | WCIRFTGNOIANOR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |