C15H14FNOS — CID 47024128
N-cyclopropyl-4-fluoro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 47024128) has the molecular formula C15H14FNOS and a molecular weight of 275.35 g/mol. Its IUPAC name is N-cyclopropyl-4-fluoro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-4-fluoro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 47024128 |
| Molecular Formula | C15H14FNOS |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-cyclopropyl-4-fluoro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(F)cc1)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C15H14FNOS/c16-12-5-3-11(4-6-12)15(18)17(13-7-8-13)10-14-2-1-9-19-14/h1-6,9,13H,7-8,10H2 |
| InChIKey | IDNBZBIJXVIDJP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |