C14H14N2O2S — CID 56811644
N-cyclopropyl-6-oxo-N-(thiophen-2-ylmethyl)-1H-pyridine-3-carboxamide (PubChem CID 56811644) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is N-cyclopropyl-6-oxo-N-(thiophen-2-ylmethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-6-oxo-N-(thiophen-2-ylmethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56811644 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-cyclopropyl-6-oxo-N-(thiophen-2-ylmethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(c1ccc(=O)[nH]c1)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C14H14N2O2S/c17-13-6-3-10(8-15-13)14(18)16(11-4-5-11)9-12-2-1-7-19-12/h1-3,6-8,11H,4-5,9H2,(H,15,17) |
| InChIKey | UAXIGGYCWSGPIX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |