C13H14N4OS — CID 62186849
6-amino-N-cyclopropyl-N-(thiophen-2-ylmethyl)pyridazine-3-carboxamide (PubChem CID 62186849) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 6-amino-N-cyclopropyl-N-(thiophen-2-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-amino-N-cyclopropyl-N-(thiophen-2-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62186849 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 6-amino-N-cyclopropyl-N-(thiophen-2-ylmethyl)pyridazine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)N(Cc2cccs2)C2CC2)nn1 |
| InChI | InChI=1S/C13H14N4OS/c14-12-6-5-11(15-16-12)13(18)17(9-3-4-9)8-10-2-1-7-19-10/h1-2,5-7,9H,3-4,8H2,(H2,14,16) |
| InChIKey | LSQVWLUNIWQPNJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |