C14H14S3 — CID 169103820
2,5-dithiophen-2-ylthiophene;ethane (PubChem CID 169103820) has the molecular formula C14H14S3 and a molecular weight of 278.47 g/mol. Its IUPAC name is 2,5-dithiophen-2-ylthiophene;ethane.
| Compound Name | 2,5-dithiophen-2-ylthiophene;ethane |
|---|---|
| PubChem CID | 169103820 |
| Molecular Formula | C14H14S3 |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2,5-dithiophen-2-ylthiophene;ethane |
| SMILES | CC.c1csc(-c2ccc(-c3cccs3)s2)c1 |
| InChI | InChI=1S/C12H8S3.C2H6/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10;1-2/h1-8H;1-2H3 |
| InChIKey | ZHSSHVWLDXDSEE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |