C18H18S2 — CID 141257815
2-(3,5-diethylphenyl)-5-thiophen-2-ylthiophene (PubChem CID 141257815) has the molecular formula C18H18S2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 2-(3,5-diethylphenyl)-5-thiophen-2-ylthiophene.
| Compound Name | 2-(3,5-diethylphenyl)-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 141257815 |
| Molecular Formula | C18H18S2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-(3,5-diethylphenyl)-5-thiophen-2-ylthiophene |
| SMILES | CCc1cc(CC)cc(-c2ccc(-c3cccs3)s2)c1 |
| InChI | InChI=1S/C18H18S2/c1-3-13-10-14(4-2)12-15(11-13)16-7-8-18(20-16)17-6-5-9-19-17/h5-12H,3-4H2,1-2H3 |
| InChIKey | OSBITSDPPGQIQZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |