C19H18OS2 — CID 141257761
5-(2,6-diethyl-4-thiophen-2-ylphenyl)thiophene-2-carbaldehyde (PubChem CID 141257761) has the molecular formula C19H18OS2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 5-(2,6-diethyl-4-thiophen-2-ylphenyl)thiophene-2-carbaldehyde.
| Compound Name | 5-(2,6-diethyl-4-thiophen-2-ylphenyl)thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 141257761 |
| Molecular Formula | C19H18OS2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 5-(2,6-diethyl-4-thiophen-2-ylphenyl)thiophene-2-carbaldehyde |
| SMILES | CCc1cc(-c2cccs2)cc(CC)c1-c1ccc(C=O)s1 |
| InChI | InChI=1S/C19H18OS2/c1-3-13-10-15(17-6-5-9-21-17)11-14(4-2)19(13)18-8-7-16(12-20)22-18/h5-12H,3-4H2,1-2H3 |
| InChIKey | UNZSJNTZUUUHQD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|