C27H19NOS2 — CID 72702102
5-[4-(N-(4-thiophen-2-ylphenyl)anilino)phenyl]thiophene-2-carbaldehyde (PubChem CID 72702102) has the molecular formula C27H19NOS2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 5-[4-(N-(4-thiophen-2-ylphenyl)anilino)phenyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[4-(N-(4-thiophen-2-ylphenyl)anilino)phenyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 72702102 |
| Molecular Formula | C27H19NOS2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 5-[4-(N-(4-thiophen-2-ylphenyl)anilino)phenyl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(N(c3ccccc3)c3ccc(-c4cccs4)cc3)cc2)s1 |
| InChI | InChI=1S/C27H19NOS2/c29-19-25-16-17-27(31-25)21-10-14-24(15-11-21)28(22-5-2-1-3-6-22)23-12-8-20(9-13-23)26-7-4-18-30-26/h1-19H |
| InChIKey | HKBKPTXFOQVMOY-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|