C26H21N3S2 — CID 102055550
4-N-(4-aminophenyl)-4-N-[4-(5-thiophen-2-ylthiophen-2-yl)phenyl]benzene-1,4-diamine (PubChem CID 102055550) has the molecular formula C26H21N3S2 and a molecular weight of 439.61 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)-4-N-[4-(5-thiophen-2-ylthiophen-2-yl)phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-(4-aminophenyl)-4-N-[4-(5-thiophen-2-ylthiophen-2-yl)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 102055550 |
| Molecular Formula | C26H21N3S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-N-(4-aminophenyl)-4-N-[4-(5-thiophen-2-ylthiophen-2-yl)phenyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(N(c2ccc(N)cc2)c2ccc(-c3ccc(-c4cccs4)s3)cc2)cc1 |
| InChI | InChI=1S/C26H21N3S2/c27-19-5-11-22(12-6-19)29(23-13-7-20(28)8-14-23)21-9-3-18(4-10-21)24-15-16-26(31-24)25-2-1-17-30-25/h1-17H,27-28H2 |
| InChIKey | SXZGJFUMXRZULE-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|