C30H27NS2 — CID 154532963
4-methyl-N-(4-methylphenyl)-N-[4-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]phenyl]aniline (PubChem CID 154532963) has the molecular formula C30H27NS2 and a molecular weight of 465.69 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)-N-[4-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]phenyl]aniline.
| Compound Name | 4-methyl-N-(4-methylphenyl)-N-[4-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]phenyl]aniline |
|---|---|
| PubChem CID | 154532963 |
| Molecular Formula | C30H27NS2 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)-N-[4-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]phenyl]aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(CCc3ccc(-c4cccs4)s3)cc2)cc1 |
| InChI | InChI=1S/C30H27NS2/c1-22-5-12-25(13-6-22)31(26-14-7-23(2)8-15-26)27-16-9-24(10-17-27)11-18-28-19-20-30(33-28)29-4-3-21-32-29/h3-10,12-17,19-21H,11,18H2,1-2H3 |
| InChIKey | QCKGAXKAGRGOFY-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |