C16H21BrS2 — CID 11013746
2-(8-bromooctyl)-5-thiophen-2-ylthiophene (PubChem CID 11013746) has the molecular formula C16H21BrS2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-(8-bromooctyl)-5-thiophen-2-ylthiophene.
| Compound Name | 2-(8-bromooctyl)-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 11013746 |
| Molecular Formula | C16H21BrS2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2-(8-bromooctyl)-5-thiophen-2-ylthiophene |
| SMILES | BrCCCCCCCCc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C16H21BrS2/c17-12-6-4-2-1-3-5-8-14-10-11-16(19-14)15-9-7-13-18-15/h7,9-11,13H,1-6,8,12H2 |
| InChIKey | QVJIFWNVRTUDJM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|