C60H64N2S10 — CID 100937102
N,N'-dimethyl-N,N'-bis[6-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]hexyl]hexane-1,6-diamine (PubChem CID 100937102) has the molecular formula C60H64N2S10 and a molecular weight of 1133.86 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis[6-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]hexyl]hexane-1,6-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis[6-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]hexyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 100937102 |
| Molecular Formula | C60H64N2S10 |
| Molecular Weight | 1133.86 g/mol |
| Exact Mass | 1132.23 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis[6-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]hexyl]hexane-1,6-diamine |
| SMILES | CN(CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5cccs5)s4)s3)s2)s1)CCCCCCN(C)CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5cccs5)s4)s3)s2)s1 |
| InChI | InChI=1S/C60H64N2S10/c1-61(37-11-5-3-9-17-43-21-23-49(65-43)51-29-31-57(69-51)59-35-33-55(71-59)53-27-25-47(67-53)45-19-15-41-63-45)39-13-7-8-14-40-62(2)38-12-6-4-10-18-44-22-24-50(66-44)52-30-32-58(70-52)60-36-34-56(72-60)54-28-26-48(68-54)46-20-16-42-64-46/h15-16,19-36,41-42H,3-14,17-18,37-40H2,1-2H3 |
| InChIKey | INVCIEANURSGKW-UHFFFAOYSA-N |
| XLogP | 21.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1133.86 |
| LogP ≤ 5 | 21.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|