C12H13NOS2 — CID 155800416
N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]acetamide (PubChem CID 155800416) has the molecular formula C12H13NOS2 and a molecular weight of 251.38 g/mol. Its IUPAC name is N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]acetamide.
| Compound Name | N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 155800416 |
| Molecular Formula | C12H13NOS2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C12H13NOS2/c1-9(14)13-7-6-10-4-5-12(16-10)11-3-2-8-15-11/h2-5,8H,6-7H2,1H3,(H,13,14) |
| InChIKey | AXVQFWOZCYXCBX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |