C12H12N2O2S2 — CID 155800302
N'-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide (PubChem CID 155800302) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N'-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide.
| Compound Name | N'-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 155800302 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N'-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide |
| SMILES | NC(=O)C(=O)NCCc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C12H12N2O2S2/c13-11(15)12(16)14-6-5-8-3-4-10(18-8)9-2-1-7-17-9/h1-4,7H,5-6H2,(H2,13,15)(H,14,16) |
| InChIKey | ZYVYSYIFOVLZGM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|