C18H16BrNO2S2 — CID 155801431
2-bromo-5-methoxy-N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]benzamide (PubChem CID 155801431) has the molecular formula C18H16BrNO2S2 and a molecular weight of 422.37 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]benzamide.
| Compound Name | 2-bromo-5-methoxy-N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 155801431 |
| Molecular Formula | C18H16BrNO2S2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | 2-bromo-5-methoxy-N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]benzamide |
| SMILES | COc1ccc(Br)c(C(=O)NCCc2ccc(-c3cccs3)s2)c1 |
| InChI | InChI=1S/C18H16BrNO2S2/c1-22-12-4-6-15(19)14(11-12)18(21)20-9-8-13-5-7-17(24-13)16-3-2-10-23-16/h2-7,10-11H,8-9H2,1H3,(H,20,21) |
| InChIKey | HVKQXCZADRXZKC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |