C18H16BrNO3S — CID 121019446
2-bromo-N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-5-methoxybenzamide (PubChem CID 121019446) has the molecular formula C18H16BrNO3S and a molecular weight of 406.30 g/mol. Its IUPAC name is 2-bromo-N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-5-methoxybenzamide.
| Compound Name | 2-bromo-N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 121019446 |
| Molecular Formula | C18H16BrNO3S |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 2-bromo-N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-5-methoxybenzamide |
| SMILES | COc1ccc(Br)c(C(=O)NCCc2ccc(-c3ccoc3)s2)c1 |
| InChI | InChI=1S/C18H16BrNO3S/c1-22-13-2-4-16(19)15(10-13)18(21)20-8-6-14-3-5-17(24-14)12-7-9-23-11-12/h2-5,7,9-11H,6,8H2,1H3,(H,20,21) |
| InChIKey | JRLVDPLBELBVAA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |