2-(5-thiophen-2-ylthiophen-2-yl)acetic acid

C10H8O2S2 — CID 70837097

IUPAC2-(5-thiophen-2-ylthiophen-2-yl)acetic acid
SMILESO=C(O)Cc1ccc(-c2cccs2)s1
InChIInChI=1S/C10H8O2S2/c11-10(12)6-7-3-4-9(14-7)8-2-1-5-13-8/h1-5H,6H2,(H,11,12)
InChIKeyQMTDKCQWNZMCAP-UHFFFAOYSA-N
MW224.31 g/mol
LogP3.10
Rot. Bonds3

About 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid

2-(5-thiophen-2-ylthiophen-2-yl)acetic acid (PubChem CID 70837097) has the molecular formula C10H8O2S2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5-thiophen-2-ylthiophen-2-yl)acetic acid
PubChem CID70837097
Molecular FormulaC10H8O2S2
Molecular Weight224.31 g/mol
Exact Mass224.00
IUPAC Name2-(5-thiophen-2-ylthiophen-2-yl)acetic acid
SMILESO=C(O)Cc1ccc(-c2cccs2)s1
InChIInChI=1S/C10H8O2S2/c11-10(12)6-7-3-4-9(14-7)8-2-1-5-13-8/h1-5H,6H2,(H,11,12)
InChIKeyQMTDKCQWNZMCAP-UHFFFAOYSA-N
XLogP3.10
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.31
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[5-[5-[5-(carboxymethyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]acetic acid
CID 67286373
4-(5-thiophen-2-ylthiophen-2-yl)butanoic acid
CID 70912798
[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]methanol
CID 15838027
2-[2-[5-[3-(carboxymethyl)-5-thiophen-2-ylthiophen-2-yl]thiophen-2-yl]-5-thiophen-2-ylthiophen-3-yl]acetic acid
CID 45254028
benzene;methane;2-thiophen-2-ylacetic acid
CID 70426530
2-[5-[(thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid
CID 82894113
N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]acetamide
CID 155800416
N'-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide
CID 155800302
2-[5-(N-hydroxy-C-thiophen-2-ylcarbonimidoyl)thiophen-2-yl]acetic acid
CID 6614337
2-[5-(2-chlorophenyl)thiophen-2-yl]acetic acid
CID 84756419
1-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]propan-2-amine
CID 170890943
[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]methyl 2-methylprop-2-enoate
CID 86183810

Frequently Asked Questions

What is the IUPAC name of 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid?
The IUPAC name of 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid (CID 70837097) is 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid.
What is the SMILES notation for 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid?
The canonical SMILES for 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid is O=C(O)Cc1ccc(-c2cccs2)s1.
What is the InChIKey of 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid?
The InChIKey is QMTDKCQWNZMCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2S2/c11-10(12)6-7-3-4-9(14-7)8-2-1-5-13-8/h1-5H,6H2,(H,11,12).
What are the key properties of 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid?
2-(5-thiophen-2-ylthiophen-2-yl)acetic acid has a molecular weight of 224.31 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-thiophen-2-ylthiophen-2-yl)acetic acid is sourced from PubChem (CID 70837097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).