C12H12O2S2 — CID 70912798
4-(5-thiophen-2-ylthiophen-2-yl)butanoic acid (PubChem CID 70912798) has the molecular formula C12H12O2S2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-(5-thiophen-2-ylthiophen-2-yl)butanoic acid.
| Compound Name | 4-(5-thiophen-2-ylthiophen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 70912798 |
| Molecular Formula | C12H12O2S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 4-(5-thiophen-2-ylthiophen-2-yl)butanoic acid |
| SMILES | O=C(O)CCCc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C12H12O2S2/c13-12(14)5-1-3-9-6-7-11(16-9)10-4-2-8-15-10/h2,4,6-8H,1,3,5H2,(H,13,14) |
| InChIKey | UYAMSPVCWYZFEP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |