About benzene;methane;2-thiophen-2-ylacetic acid
benzene;methane;2-thiophen-2-ylacetic acid (PubChem CID 70426530) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is benzene;methane;2-thiophen-2-ylacetic acid.
Molecular Properties
| Compound Name | benzene;methane;2-thiophen-2-ylacetic acid |
| PubChem CID | 70426530 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | benzene;methane;2-thiophen-2-ylacetic acid |
| SMILES | C.O=C(O)Cc1cccs1.c1ccccc1 |
| InChI | InChI=1S/C6H6O2S.C6H6.CH4/c7-6(8)4-5-2-1-3-9-5;1-2-4-6-5-3-1;/h1-3H,4H2,(H,7,8);1-6H;1H4 |
| InChIKey | HJVVOXMTYITRAW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;methane;2-thiophen-2-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;methane;2-thiophen-2-ylacetic acid?
The IUPAC name of benzene;methane;2-thiophen-2-ylacetic acid (CID 70426530) is benzene;methane;2-thiophen-2-ylacetic acid.
What is the SMILES notation for benzene;methane;2-thiophen-2-ylacetic acid?
The canonical SMILES for benzene;methane;2-thiophen-2-ylacetic acid is C.O=C(O)Cc1cccs1.c1ccccc1.
What is the InChIKey of benzene;methane;2-thiophen-2-ylacetic acid?
The InChIKey is HJVVOXMTYITRAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2S.C6H6.CH4/c7-6(8)4-5-2-1-3-9-5;1-2-4-6-5-3-1;/h1-3H,4H2,(H,7,8);1-6H;1H4.
What are the key properties of benzene;methane;2-thiophen-2-ylacetic acid?
benzene;methane;2-thiophen-2-ylacetic acid has a molecular weight of 236.34 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;methane;2-thiophen-2-ylacetic acid is sourced from PubChem (CID 70426530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).