benzene;methane;2-thiophen-2-ylacetic acid

C13H16O2S — CID 70426530

IUPACbenzene;methane;2-thiophen-2-ylacetic acid
SMILESC.O=C(O)Cc1cccs1.c1ccccc1
InChIInChI=1S/C6H6O2S.C6H6.CH4/c7-6(8)4-5-2-1-3-9-5;1-2-4-6-5-3-1;/h1-3H,4H2,(H,7,8);1-6H;1H4
InChIKeyHJVVOXMTYITRAW-UHFFFAOYSA-N
MW236.34 g/mol
LogP3.70
Rot. Bonds2

About benzene;methane;2-thiophen-2-ylacetic acid

benzene;methane;2-thiophen-2-ylacetic acid (PubChem CID 70426530) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is benzene;methane;2-thiophen-2-ylacetic acid.

Molecular Properties

Compound Namebenzene;methane;2-thiophen-2-ylacetic acid
PubChem CID70426530
Molecular FormulaC13H16O2S
Molecular Weight236.34 g/mol
Exact Mass236.09
IUPAC Namebenzene;methane;2-thiophen-2-ylacetic acid
SMILESC.O=C(O)Cc1cccs1.c1ccccc1
InChIInChI=1S/C6H6O2S.C6H6.CH4/c7-6(8)4-5-2-1-3-9-5;1-2-4-6-5-3-1;/h1-3H,4H2,(H,7,8);1-6H;1H4
InChIKeyHJVVOXMTYITRAW-UHFFFAOYSA-N
XLogP3.70
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.34
LogP ≤ 53.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze benzene;methane;2-thiophen-2-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzene;methane;2-thiophen-2-ylacetic acid?
The IUPAC name of benzene;methane;2-thiophen-2-ylacetic acid (CID 70426530) is benzene;methane;2-thiophen-2-ylacetic acid.
What is the SMILES notation for benzene;methane;2-thiophen-2-ylacetic acid?
The canonical SMILES for benzene;methane;2-thiophen-2-ylacetic acid is C.O=C(O)Cc1cccs1.c1ccccc1.
What is the InChIKey of benzene;methane;2-thiophen-2-ylacetic acid?
The InChIKey is HJVVOXMTYITRAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2S.C6H6.CH4/c7-6(8)4-5-2-1-3-9-5;1-2-4-6-5-3-1;/h1-3H,4H2,(H,7,8);1-6H;1H4.
What are the key properties of benzene;methane;2-thiophen-2-ylacetic acid?
benzene;methane;2-thiophen-2-ylacetic acid has a molecular weight of 236.34 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;methane;2-thiophen-2-ylacetic acid is sourced from PubChem (CID 70426530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).