C8H10N2O3S — CID 19834259
2-[2-(2-thiophen-2-ylacetyl)hydrazinyl]acetic acid (PubChem CID 19834259) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-[2-(2-thiophen-2-ylacetyl)hydrazinyl]acetic acid.
| Compound Name | 2-[2-(2-thiophen-2-ylacetyl)hydrazinyl]acetic acid |
|---|---|
| PubChem CID | 19834259 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-[2-(2-thiophen-2-ylacetyl)hydrazinyl]acetic acid |
| SMILES | O=C(O)CNNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C8H10N2O3S/c11-7(10-9-5-8(12)13)4-6-2-1-3-14-6/h1-3,9H,4-5H2,(H,10,11)(H,12,13) |
| InChIKey | LCJGTSHDZLUHGL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|