About 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene
2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene (PubChem CID 22416732) has the molecular formula C11H12O3S2
and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene.
Molecular Properties
| Compound Name | 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene |
| PubChem CID | 22416732 |
| Molecular Formula | C11H12O3S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene |
| SMILES | O=C(O)CO.c1csc(Cc2cccs2)c1 |
| InChI | InChI=1S/C9H8S2.C2H4O3/c1-3-8(10-5-1)7-9-4-2-6-11-9;3-1-2(4)5/h1-6H,7H2;3H,1H2,(H,4,5) |
| InChIKey | QLGFWQNWJDJWQL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene?
The IUPAC name of 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene (CID 22416732) is 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene.
What is the SMILES notation for 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene?
The canonical SMILES for 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene is O=C(O)CO.c1csc(Cc2cccs2)c1.
What is the InChIKey of 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene?
The InChIKey is QLGFWQNWJDJWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8S2.C2H4O3/c1-3-8(10-5-1)7-9-4-2-6-11-9;3-1-2(4)5/h1-6H,7H2;3H,1H2,(H,4,5).
What are the key properties of 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene?
2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene has a molecular weight of 256.35 g/mol, XLogP of 2.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetic acid;2-(thiophen-2-ylmethyl)thiophene is sourced from PubChem (CID 22416732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).