C10H9NO3S3 — CID 54008190
2-[4-hydroxy-2-sulfanylidene-5-(thiophen-2-ylmethyl)-1,3-thiazol-3-yl]acetic acid (PubChem CID 54008190) has the molecular formula C10H9NO3S3 and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-[4-hydroxy-2-sulfanylidene-5-(thiophen-2-ylmethyl)-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[4-hydroxy-2-sulfanylidene-5-(thiophen-2-ylmethyl)-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 54008190 |
| Molecular Formula | C10H9NO3S3 |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 2-[4-hydroxy-2-sulfanylidene-5-(thiophen-2-ylmethyl)-1,3-thiazol-3-yl]acetic acid |
| SMILES | O=C(O)Cn1c(O)c(Cc2cccs2)sc1=S |
| InChI | InChI=1S/C10H9NO3S3/c12-8(13)5-11-9(14)7(17-10(11)15)4-6-2-1-3-16-6/h1-3,14H,4-5H2,(H,12,13) |
| InChIKey | KQJVFGAYLOQXGF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|