C13H8OS5 — CID 10854676
[2-sulfanylidene-5-(thiophen-2-ylmethyl)-1,3-dithiol-4-yl]-thiophen-2-ylmethanone (PubChem CID 10854676) has the molecular formula C13H8OS5 and a molecular weight of 340.54 g/mol. Its IUPAC name is [2-sulfanylidene-5-(thiophen-2-ylmethyl)-1,3-dithiol-4-yl]-thiophen-2-ylmethanone.
| Compound Name | [2-sulfanylidene-5-(thiophen-2-ylmethyl)-1,3-dithiol-4-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 10854676 |
| Molecular Formula | C13H8OS5 |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 339.92 |
| IUPAC Name | [2-sulfanylidene-5-(thiophen-2-ylmethyl)-1,3-dithiol-4-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)c1sc(=S)sc1Cc1cccs1 |
| InChI | InChI=1S/C13H8OS5/c14-11(9-4-2-6-17-9)12-10(18-13(15)19-12)7-8-3-1-5-16-8/h1-6H,7H2 |
| InChIKey | PDGHYZKDEQFFSP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|