About sodium thiophene-2-carboxylate
sodium thiophene-2-carboxylate (PubChem CID 23672340) has the molecular formula C5H3NaO2S
and a molecular weight of 150.13 g/mol. Its IUPAC name is sodium thiophene-2-carboxylate.
Molecular Properties
| Compound Name | sodium thiophene-2-carboxylate |
| PubChem CID | 23672340 |
| Molecular Formula | C5H3NaO2S |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 149.98 |
| IUPAC Name | sodium thiophene-2-carboxylate |
| SMILES | O=C([O-])c1cccs1.[Na+] |
| InChI | InChI=1S/C5H4O2S.Na/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1 |
| InChIKey | LKYIPGJOXSVWPX-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium thiophene-2-carboxylate?
The IUPAC name of sodium thiophene-2-carboxylate (CID 23672340) is sodium thiophene-2-carboxylate.
What is the SMILES notation for sodium thiophene-2-carboxylate?
The canonical SMILES for sodium thiophene-2-carboxylate is O=C([O-])c1cccs1.[Na+].
What is the InChIKey of sodium thiophene-2-carboxylate?
The InChIKey is LKYIPGJOXSVWPX-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4O2S.Na/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1.
What are the key properties of sodium thiophene-2-carboxylate?
sodium thiophene-2-carboxylate has a molecular weight of 150.13 g/mol, XLogP of -2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium thiophene-2-carboxylate is sourced from PubChem (CID 23672340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).