C18H12S4 — CID 15249530
2-(1,2,2-trithiophen-2-ylethenyl)thiophene (PubChem CID 15249530) has the molecular formula C18H12S4 and a molecular weight of 356.56 g/mol. Its IUPAC name is 2-(1,2,2-trithiophen-2-ylethenyl)thiophene.
| Compound Name | 2-(1,2,2-trithiophen-2-ylethenyl)thiophene |
|---|---|
| PubChem CID | 15249530 |
| Molecular Formula | C18H12S4 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 2-(1,2,2-trithiophen-2-ylethenyl)thiophene |
| SMILES | c1csc(C(=C(c2cccs2)c2cccs2)c2cccs2)c1 |
| InChI | InChI=1S/C18H12S4/c1-5-13(19-9-1)17(14-6-2-10-20-14)18(15-7-3-11-21-15)16-8-4-12-22-16/h1-12H |
| InChIKey | HNHRZULVAOZEJG-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |