About formaldehyde;thiophene-2-carboxylic acid
formaldehyde;thiophene-2-carboxylic acid (PubChem CID 158716916) has the molecular formula C6H6O3S
and a molecular weight of 158.18 g/mol. Its IUPAC name is formaldehyde;thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | formaldehyde;thiophene-2-carboxylic acid |
| PubChem CID | 158716916 |
| Molecular Formula | C6H6O3S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | formaldehyde;thiophene-2-carboxylic acid |
| SMILES | C=O.O=C(O)c1cccs1 |
| InChI | InChI=1S/C5H4O2S.CH2O/c6-5(7)4-2-1-3-8-4;1-2/h1-3H,(H,6,7);1H2 |
| InChIKey | IJKSOWFBJLOYIQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;thiophene-2-carboxylic acid?
The IUPAC name of formaldehyde;thiophene-2-carboxylic acid (CID 158716916) is formaldehyde;thiophene-2-carboxylic acid.
What is the SMILES notation for formaldehyde;thiophene-2-carboxylic acid?
The canonical SMILES for formaldehyde;thiophene-2-carboxylic acid is C=O.O=C(O)c1cccs1.
What is the InChIKey of formaldehyde;thiophene-2-carboxylic acid?
The InChIKey is IJKSOWFBJLOYIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O2S.CH2O/c6-5(7)4-2-1-3-8-4;1-2/h1-3H,(H,6,7);1H2.
What are the key properties of formaldehyde;thiophene-2-carboxylic acid?
formaldehyde;thiophene-2-carboxylic acid has a molecular weight of 158.18 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;thiophene-2-carboxylic acid is sourced from PubChem (CID 158716916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).