About thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid
thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid (PubChem CID 122587949) has the molecular formula C10H7ClO3S2
and a molecular weight of 274.75 g/mol. Its IUPAC name is thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid |
| PubChem CID | 122587949 |
| Molecular Formula | C10H7ClO3S2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid |
| SMILES | O=C(Cl)c1cccs1.O=C(O)c1cccs1 |
| InChI | InChI=1S/C5H3ClOS.C5H4O2S/c2*6-5(7)4-2-1-3-8-4/h1-3H;1-3H,(H,6,7) |
| InChIKey | RETHZTUCOHALFS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid?
The IUPAC name of thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid (CID 122587949) is thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid.
What is the SMILES notation for thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid?
The canonical SMILES for thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid is O=C(Cl)c1cccs1.O=C(O)c1cccs1.
What is the InChIKey of thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid?
The InChIKey is RETHZTUCOHALFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClOS.C5H4O2S/c2*6-5(7)4-2-1-3-8-4/h1-3H;1-3H,(H,6,7).
What are the key properties of thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid?
thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid has a molecular weight of 274.75 g/mol, XLogP of 3.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-2-carbonyl chloride;thiophene-2-carboxylic acid is sourced from PubChem (CID 122587949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).