About 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene
2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene (PubChem CID 11139311) has the molecular formula C14H10S2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene.
Molecular Properties
| Compound Name | 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene |
| PubChem CID | 11139311 |
| Molecular Formula | C14H10S2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene |
| SMILES | C1=CC(=C(c2cccs2)c2cccs2)C=C1 |
| InChI | InChI=1S/C14H10S2/c1-2-6-11(5-1)14(12-7-3-9-15-12)13-8-4-10-16-13/h1-10H |
| InChIKey | VZTAAIOBXCKZCF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene?
The IUPAC name of 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene (CID 11139311) is 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene.
What is the SMILES notation for 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene?
The canonical SMILES for 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene is C1=CC(=C(c2cccs2)c2cccs2)C=C1.
What is the InChIKey of 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene?
The InChIKey is VZTAAIOBXCKZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10S2/c1-2-6-11(5-1)14(12-7-3-9-15-12)13-8-4-10-16-13/h1-10H.
What are the key properties of 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene?
2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene has a molecular weight of 242.37 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopenta-2,4-dien-1-ylidene(thiophen-2-yl)methyl]thiophene is sourced from PubChem (CID 11139311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).