C22H16S2 — CID 10688838
2-[(E)-1,2-diphenyl-2-thiophen-2-ylethenyl]thiophene (PubChem CID 10688838) has the molecular formula C22H16S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-[(E)-1,2-diphenyl-2-thiophen-2-ylethenyl]thiophene.
| Compound Name | 2-[(E)-1,2-diphenyl-2-thiophen-2-ylethenyl]thiophene |
|---|---|
| PubChem CID | 10688838 |
| Molecular Formula | C22H16S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[(E)-1,2-diphenyl-2-thiophen-2-ylethenyl]thiophene |
| SMILES | c1ccc(/C(=C(/c2ccccc2)c2cccs2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H16S2/c1-3-9-17(10-4-1)21(19-13-7-15-23-19)22(20-14-8-16-24-20)18-11-5-2-6-12-18/h1-16H/b22-21+ |
| InChIKey | VVIRYVZOLOHIKT-QURGRASLSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|