About [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate
[1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate (PubChem CID 140844707) has the molecular formula C24H16O4S2
and a molecular weight of 432.52 g/mol. Its IUPAC name is [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate |
| PubChem CID | 140844707 |
| Molecular Formula | C24H16O4S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate |
| SMILES | O=C(OC(=C(OC(=O)c1cccs1)c1ccccc1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C24H16O4S2/c25-23(19-13-7-15-29-19)27-21(17-9-3-1-4-10-17)22(18-11-5-2-6-12-18)28-24(26)20-14-8-16-30-20/h1-16H |
| InChIKey | BTIGHRBPHNJZIC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate?
The IUPAC name of [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate (CID 140844707) is [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate.
What is the SMILES notation for [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate?
The canonical SMILES for [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate is O=C(OC(=C(OC(=O)c1cccs1)c1ccccc1)c1ccccc1)c1cccs1.
What is the InChIKey of [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate?
The InChIKey is BTIGHRBPHNJZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16O4S2/c25-23(19-13-7-15-29-19)27-21(17-9-3-1-4-10-17)22(18-11-5-2-6-12-18)28-24(26)20-14-8-16-30-20/h1-16H.
What are the key properties of [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate?
[1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate has a molecular weight of 432.52 g/mol, XLogP of 6.35, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-diphenyl-2-(thiophene-2-carbonyloxy)ethenyl] thiophene-2-carboxylate is sourced from PubChem (CID 140844707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).