C19H14O3S — CID 849635
[(1S)-2-oxo-1,2-diphenylethyl] thiophene-2-carboxylate (PubChem CID 849635) has the molecular formula C19H14O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is [(1S)-2-oxo-1,2-diphenylethyl] thiophene-2-carboxylate.
| Compound Name | [(1S)-2-oxo-1,2-diphenylethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 849635 |
| Molecular Formula | C19H14O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [(1S)-2-oxo-1,2-diphenylethyl] thiophene-2-carboxylate |
| SMILES | O=C(O[C@H](C(=O)c1ccccc1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C19H14O3S/c20-17(14-8-3-1-4-9-14)18(15-10-5-2-6-11-15)22-19(21)16-12-7-13-23-16/h1-13,18H/t18-/m0/s1 |
| InChIKey | QPGWMWCEIKSFHQ-SFHVURJKSA-N |
| XLogP | 4.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |