About (2-oxo-1-phenylpropyl) thiophene-2-carboxylate
(2-oxo-1-phenylpropyl) thiophene-2-carboxylate (PubChem CID 134968020) has the molecular formula C14H12O3S
and a molecular weight of 260.31 g/mol. Its IUPAC name is (2-oxo-1-phenylpropyl) thiophene-2-carboxylate.
Molecular Properties
| Compound Name | (2-oxo-1-phenylpropyl) thiophene-2-carboxylate |
| PubChem CID | 134968020 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (2-oxo-1-phenylpropyl) thiophene-2-carboxylate |
| SMILES | CC(=O)C(OC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3S/c1-10(15)13(11-6-3-2-4-7-11)17-14(16)12-8-5-9-18-12/h2-9,13H,1H3 |
| InChIKey | TYUUIYOHXWLXCV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-oxo-1-phenylpropyl) thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1-phenylpropyl) thiophene-2-carboxylate?
The IUPAC name of (2-oxo-1-phenylpropyl) thiophene-2-carboxylate (CID 134968020) is (2-oxo-1-phenylpropyl) thiophene-2-carboxylate.
What is the SMILES notation for (2-oxo-1-phenylpropyl) thiophene-2-carboxylate?
The canonical SMILES for (2-oxo-1-phenylpropyl) thiophene-2-carboxylate is CC(=O)C(OC(=O)c1cccs1)c1ccccc1.
What is the InChIKey of (2-oxo-1-phenylpropyl) thiophene-2-carboxylate?
The InChIKey is TYUUIYOHXWLXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3S/c1-10(15)13(11-6-3-2-4-7-11)17-14(16)12-8-5-9-18-12/h2-9,13H,1H3.
What are the key properties of (2-oxo-1-phenylpropyl) thiophene-2-carboxylate?
(2-oxo-1-phenylpropyl) thiophene-2-carboxylate has a molecular weight of 260.31 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1-phenylpropyl) thiophene-2-carboxylate is sourced from PubChem (CID 134968020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).