About benzamido thiophene-2-carboxylate
benzamido thiophene-2-carboxylate (PubChem CID 2804175) has the molecular formula C12H9NO3S
and a molecular weight of 247.28 g/mol. Its IUPAC name is benzamido thiophene-2-carboxylate.
Molecular Properties
| Compound Name | benzamido thiophene-2-carboxylate |
| PubChem CID | 2804175 |
| Molecular Formula | C12H9NO3S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | benzamido thiophene-2-carboxylate |
| SMILES | O=C(NOC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C12H9NO3S/c14-11(9-5-2-1-3-6-9)13-16-12(15)10-7-4-8-17-10/h1-8H,(H,13,14) |
| InChIKey | KNVRWMQVMDJPMS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamido thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido thiophene-2-carboxylate?
The IUPAC name of benzamido thiophene-2-carboxylate (CID 2804175) is benzamido thiophene-2-carboxylate.
What is the SMILES notation for benzamido thiophene-2-carboxylate?
The canonical SMILES for benzamido thiophene-2-carboxylate is O=C(NOC(=O)c1cccs1)c1ccccc1.
What is the InChIKey of benzamido thiophene-2-carboxylate?
The InChIKey is KNVRWMQVMDJPMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3S/c14-11(9-5-2-1-3-6-9)13-16-12(15)10-7-4-8-17-10/h1-8H,(H,13,14).
What are the key properties of benzamido thiophene-2-carboxylate?
benzamido thiophene-2-carboxylate has a molecular weight of 247.28 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido thiophene-2-carboxylate is sourced from PubChem (CID 2804175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).