About benzamide;thiophene-2-carboxamide
benzamide;thiophene-2-carboxamide (PubChem CID 174752818) has the molecular formula C12H12N2O2S
and a molecular weight of 248.31 g/mol. Its IUPAC name is benzamide;thiophene-2-carboxamide.
Molecular Properties
| Compound Name | benzamide;thiophene-2-carboxamide |
| PubChem CID | 174752818 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | benzamide;thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccccc1.NC(=O)c1cccs1 |
| InChI | InChI=1S/C7H7NO.C5H5NOS/c8-7(9)6-4-2-1-3-5-6;6-5(7)4-2-1-3-8-4/h1-5H,(H2,8,9);1-3H,(H2,6,7) |
| InChIKey | XGCYWIXJPFUPNF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzamide;thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;thiophene-2-carboxamide?
The IUPAC name of benzamide;thiophene-2-carboxamide (CID 174752818) is benzamide;thiophene-2-carboxamide.
What is the SMILES notation for benzamide;thiophene-2-carboxamide?
The canonical SMILES for benzamide;thiophene-2-carboxamide is NC(=O)c1ccccc1.NC(=O)c1cccs1.
What is the InChIKey of benzamide;thiophene-2-carboxamide?
The InChIKey is XGCYWIXJPFUPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C5H5NOS/c8-7(9)6-4-2-1-3-5-6;6-5(7)4-2-1-3-8-4/h1-5H,(H2,8,9);1-3H,(H2,6,7).
What are the key properties of benzamide;thiophene-2-carboxamide?
benzamide;thiophene-2-carboxamide has a molecular weight of 248.31 g/mol, XLogP of 1.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;thiophene-2-carboxamide is sourced from PubChem (CID 174752818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).