About formic acid;thiophene-2-carboxamide
formic acid;thiophene-2-carboxamide (PubChem CID 118356394) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is formic acid;thiophene-2-carboxamide.
Molecular Properties
| Compound Name | formic acid;thiophene-2-carboxamide |
| PubChem CID | 118356394 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | formic acid;thiophene-2-carboxamide |
| SMILES | NC(=O)c1cccs1.O=CO |
| InChI | InChI=1S/C5H5NOS.CH2O2/c6-5(7)4-2-1-3-8-4;2-1-3/h1-3H,(H2,6,7);1H,(H,2,3) |
| InChIKey | VGTQGJQOZKMKHQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;thiophene-2-carboxamide?
The IUPAC name of formic acid;thiophene-2-carboxamide (CID 118356394) is formic acid;thiophene-2-carboxamide.
What is the SMILES notation for formic acid;thiophene-2-carboxamide?
The canonical SMILES for formic acid;thiophene-2-carboxamide is NC(=O)c1cccs1.O=CO.
What is the InChIKey of formic acid;thiophene-2-carboxamide?
The InChIKey is VGTQGJQOZKMKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NOS.CH2O2/c6-5(7)4-2-1-3-8-4;2-1-3/h1-3H,(H2,6,7);1H,(H,2,3).
What are the key properties of formic acid;thiophene-2-carboxamide?
formic acid;thiophene-2-carboxamide has a molecular weight of 173.19 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;thiophene-2-carboxamide is sourced from PubChem (CID 118356394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).