About azane;formyl thiophene-2-carboxylate
azane;formyl thiophene-2-carboxylate (PubChem CID 174676100) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is azane;formyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | azane;formyl thiophene-2-carboxylate |
| PubChem CID | 174676100 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | azane;formyl thiophene-2-carboxylate |
| SMILES | N.O=COC(=O)c1cccs1 |
| InChI | InChI=1S/C6H4O3S.H3N/c7-4-9-6(8)5-2-1-3-10-5;/h1-4H;1H3 |
| InChIKey | OZQZRSFEHLNXCI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;formyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;formyl thiophene-2-carboxylate?
The IUPAC name of azane;formyl thiophene-2-carboxylate (CID 174676100) is azane;formyl thiophene-2-carboxylate.
What is the SMILES notation for azane;formyl thiophene-2-carboxylate?
The canonical SMILES for azane;formyl thiophene-2-carboxylate is N.O=COC(=O)c1cccs1.
What is the InChIKey of azane;formyl thiophene-2-carboxylate?
The InChIKey is OZQZRSFEHLNXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O3S.H3N/c7-4-9-6(8)5-2-1-3-10-5;/h1-4H;1H3.
What are the key properties of azane;formyl thiophene-2-carboxylate?
azane;formyl thiophene-2-carboxylate has a molecular weight of 173.19 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;formyl thiophene-2-carboxylate is sourced from PubChem (CID 174676100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).