About S-hydroxy thiophene-2-carbothioate
S-hydroxy thiophene-2-carbothioate (PubChem CID 134893534) has the molecular formula C5H4O2S2
and a molecular weight of 160.22 g/mol. Its IUPAC name is S-hydroxy thiophene-2-carbothioate.
Molecular Properties
| Compound Name | S-hydroxy thiophene-2-carbothioate |
| PubChem CID | 134893534 |
| Molecular Formula | C5H4O2S2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 159.97 |
| IUPAC Name | S-hydroxy thiophene-2-carbothioate |
| SMILES | O=C(SO)c1cccs1 |
| InChI | InChI=1S/C5H4O2S2/c6-5(9-7)4-2-1-3-8-4/h1-3,7H |
| InChIKey | VRWSUOGNLDKTTG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-hydroxy thiophene-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-hydroxy thiophene-2-carbothioate?
The IUPAC name of S-hydroxy thiophene-2-carbothioate (CID 134893534) is S-hydroxy thiophene-2-carbothioate.
What is the SMILES notation for S-hydroxy thiophene-2-carbothioate?
The canonical SMILES for S-hydroxy thiophene-2-carbothioate is O=C(SO)c1cccs1.
What is the InChIKey of S-hydroxy thiophene-2-carbothioate?
The InChIKey is VRWSUOGNLDKTTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O2S2/c6-5(9-7)4-2-1-3-8-4/h1-3,7H.
What are the key properties of S-hydroxy thiophene-2-carbothioate?
S-hydroxy thiophene-2-carbothioate has a molecular weight of 160.22 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-hydroxy thiophene-2-carbothioate is sourced from PubChem (CID 134893534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).