About S-(2-acetylphenyl) thiophene-2-carbothioate
S-(2-acetylphenyl) thiophene-2-carbothioate (PubChem CID 154710778) has the molecular formula C13H10O2S2
and a molecular weight of 262.36 g/mol. Its IUPAC name is S-(2-acetylphenyl) thiophene-2-carbothioate.
Molecular Properties
| Compound Name | S-(2-acetylphenyl) thiophene-2-carbothioate |
| PubChem CID | 154710778 |
| Molecular Formula | C13H10O2S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | S-(2-acetylphenyl) thiophene-2-carbothioate |
| SMILES | CC(=O)c1ccccc1SC(=O)c1cccs1 |
| InChI | InChI=1S/C13H10O2S2/c1-9(14)10-5-2-3-6-11(10)17-13(15)12-7-4-8-16-12/h2-8H,1H3 |
| InChIKey | GHWXEIFGSVDFGM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetylphenyl) thiophene-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetylphenyl) thiophene-2-carbothioate?
The IUPAC name of S-(2-acetylphenyl) thiophene-2-carbothioate (CID 154710778) is S-(2-acetylphenyl) thiophene-2-carbothioate.
What is the SMILES notation for S-(2-acetylphenyl) thiophene-2-carbothioate?
The canonical SMILES for S-(2-acetylphenyl) thiophene-2-carbothioate is CC(=O)c1ccccc1SC(=O)c1cccs1.
What is the InChIKey of S-(2-acetylphenyl) thiophene-2-carbothioate?
The InChIKey is GHWXEIFGSVDFGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2S2/c1-9(14)10-5-2-3-6-11(10)17-13(15)12-7-4-8-16-12/h2-8H,1H3.
What are the key properties of S-(2-acetylphenyl) thiophene-2-carbothioate?
S-(2-acetylphenyl) thiophene-2-carbothioate has a molecular weight of 262.36 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetylphenyl) thiophene-2-carbothioate is sourced from PubChem (CID 154710778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).