About benzoic acid;ethane;1-thiophen-2-ylethanone
benzoic acid;ethane;1-thiophen-2-ylethanone (PubChem CID 158279091) has the molecular formula C17H24O3S
and a molecular weight of 308.44 g/mol. Its IUPAC name is benzoic acid;ethane;1-thiophen-2-ylethanone.
Molecular Properties
| Compound Name | benzoic acid;ethane;1-thiophen-2-ylethanone |
| PubChem CID | 158279091 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | benzoic acid;ethane;1-thiophen-2-ylethanone |
| SMILES | CC.CC.CC(=O)c1cccs1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H6OS.2C2H6/c8-7(9)6-4-2-1-3-5-6;1-5(7)6-3-2-4-8-6;2*1-2/h1-5H,(H,8,9);2-4H,1H3;2*1-2H3 |
| InChIKey | GJZHNYHSQHLYHJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzoic acid;ethane;1-thiophen-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;ethane;1-thiophen-2-ylethanone?
The IUPAC name of benzoic acid;ethane;1-thiophen-2-ylethanone (CID 158279091) is benzoic acid;ethane;1-thiophen-2-ylethanone.
What is the SMILES notation for benzoic acid;ethane;1-thiophen-2-ylethanone?
The canonical SMILES for benzoic acid;ethane;1-thiophen-2-ylethanone is CC.CC.CC(=O)c1cccs1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;ethane;1-thiophen-2-ylethanone?
The InChIKey is GJZHNYHSQHLYHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H6OS.2C2H6/c8-7(9)6-4-2-1-3-5-6;1-5(7)6-3-2-4-8-6;2*1-2/h1-5H,(H,8,9);2-4H,1H3;2*1-2H3.
What are the key properties of benzoic acid;ethane;1-thiophen-2-ylethanone?
benzoic acid;ethane;1-thiophen-2-ylethanone has a molecular weight of 308.44 g/mol, XLogP of 5.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;ethane;1-thiophen-2-ylethanone is sourced from PubChem (CID 158279091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).