C20H16N2O4S2 — CID 102388216
S-[2-[(2,6-dimethylphenyl)carbamoyl]-4-nitrophenyl] thiophene-2-carbothioate (PubChem CID 102388216) has the molecular formula C20H16N2O4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is S-[2-[(2,6-dimethylphenyl)carbamoyl]-4-nitrophenyl] thiophene-2-carbothioate.
| Compound Name | S-[2-[(2,6-dimethylphenyl)carbamoyl]-4-nitrophenyl] thiophene-2-carbothioate |
|---|---|
| PubChem CID | 102388216 |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | S-[2-[(2,6-dimethylphenyl)carbamoyl]-4-nitrophenyl] thiophene-2-carbothioate |
| SMILES | Cc1cccc(C)c1NC(=O)c1cc([N+](=O)[O-])ccc1SC(=O)c1cccs1 |
| InChI | InChI=1S/C20H16N2O4S2/c1-12-5-3-6-13(2)18(12)21-19(23)15-11-14(22(25)26)8-9-16(15)28-20(24)17-7-4-10-27-17/h3-11H,1-2H3,(H,21,23) |
| InChIKey | FGJVDVRCJHBZMT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|