C17H17N3O5 — CID 3565991
N-(2-methyl-6-propan-2-ylphenyl)-2,4-dinitrobenzamide (PubChem CID 3565991) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is N-(2-methyl-6-propan-2-ylphenyl)-2,4-dinitrobenzamide.
| Compound Name | N-(2-methyl-6-propan-2-ylphenyl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3565991 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(2-methyl-6-propan-2-ylphenyl)-2,4-dinitrobenzamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O5/c1-10(2)13-6-4-5-11(3)16(13)18-17(21)14-8-7-12(19(22)23)9-15(14)20(24)25/h4-10H,1-3H3,(H,18,21) |
| InChIKey | JMANYBYUNCAVNU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|