C28H41N3O4 — CID 158896077
N-[2,6-di(propan-2-yl)phenyl]acetamide;N-[4-nitro-2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 158896077) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]acetamide;N-[4-nitro-2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]acetamide;N-[4-nitro-2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 158896077 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]acetamide;N-[4-nitro-2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1c(C(C)C)cc([N+](=O)[O-])cc1C(C)C.CC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C14H20N2O3.C14H21NO/c1-8(2)12-6-11(16(18)19)7-13(9(3)4)14(12)15-10(5)17;1-9(2)12-7-6-8-13(10(3)4)14(12)15-11(5)16/h6-9H,1-5H3,(H,15,17);6-10H,1-5H3,(H,15,16) |
| InChIKey | JEVRLKZAWAPAOR-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|