About formyl thiophene-2-carboxylate
formyl thiophene-2-carboxylate (PubChem CID 22645353) has the molecular formula C6H4O3S
and a molecular weight of 156.16 g/mol. Its IUPAC name is formyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | formyl thiophene-2-carboxylate |
| PubChem CID | 22645353 |
| Molecular Formula | C6H4O3S |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 155.99 |
| IUPAC Name | formyl thiophene-2-carboxylate |
| SMILES | O=COC(=O)c1cccs1 |
| InChI | InChI=1S/C6H4O3S/c7-4-9-6(8)5-2-1-3-10-5/h1-4H |
| InChIKey | XNGSMAIKRRGMSK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl thiophene-2-carboxylate?
The IUPAC name of formyl thiophene-2-carboxylate (CID 22645353) is formyl thiophene-2-carboxylate.
What is the SMILES notation for formyl thiophene-2-carboxylate?
The canonical SMILES for formyl thiophene-2-carboxylate is O=COC(=O)c1cccs1.
What is the InChIKey of formyl thiophene-2-carboxylate?
The InChIKey is XNGSMAIKRRGMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O3S/c7-4-9-6(8)5-2-1-3-10-5/h1-4H.
What are the key properties of formyl thiophene-2-carboxylate?
formyl thiophene-2-carboxylate has a molecular weight of 156.16 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formyl thiophene-2-carboxylate is sourced from PubChem (CID 22645353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).