About dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene
dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene (PubChem CID 161486915) has the molecular formula C17H12OS4
and a molecular weight of 360.55 g/mol. Its IUPAC name is dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene.
Molecular Properties
| Compound Name | dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene |
| PubChem CID | 161486915 |
| Molecular Formula | C17H12OS4 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene |
| SMILES | O=C(c1cccs1)c1cccs1.c1csc(-c2cccs2)c1 |
| InChI | InChI=1S/C9H6OS2.C8H6S2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8;1-3-7(9-5-1)8-4-2-6-10-8/h1-6H;1-6H |
| InChIKey | WFBYZUWVSCBFNU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene?
The IUPAC name of dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene (CID 161486915) is dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene.
What is the SMILES notation for dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene?
The canonical SMILES for dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene is O=C(c1cccs1)c1cccs1.c1csc(-c2cccs2)c1.
What is the InChIKey of dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene?
The InChIKey is WFBYZUWVSCBFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6OS2.C8H6S2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8;1-3-7(9-5-1)8-4-2-6-10-8/h1-6H;1-6H.
What are the key properties of dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene?
dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene has a molecular weight of 360.55 g/mol, XLogP of 6.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dithiophen-2-ylmethanone;2-thiophen-2-ylthiophene is sourced from PubChem (CID 161486915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).