C15H14O3S3 — CID 21434714
2,3-dimethoxythiophene;dithiophen-2-ylmethanone (PubChem CID 21434714) has the molecular formula C15H14O3S3 and a molecular weight of 338.48 g/mol. Its IUPAC name is 2,3-dimethoxythiophene;dithiophen-2-ylmethanone.
| Compound Name | 2,3-dimethoxythiophene;dithiophen-2-ylmethanone |
|---|---|
| PubChem CID | 21434714 |
| Molecular Formula | C15H14O3S3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2,3-dimethoxythiophene;dithiophen-2-ylmethanone |
| SMILES | COc1ccsc1OC.O=C(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C9H6OS2.C6H8O2S/c10-9(7-3-1-5-11-7)8-4-2-6-12-8;1-7-5-3-4-9-6(5)8-2/h1-6H;3-4H,1-2H3 |
| InChIKey | ZRQVBYIPQPICNE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |