C18H8O2S5 — CID 102424318
[10-(thiophene-2-carbonyl)-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-thiophen-2-ylmethanone (PubChem CID 102424318) has the molecular formula C18H8O2S5 and a molecular weight of 416.60 g/mol. Its IUPAC name is [10-(thiophene-2-carbonyl)-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-thiophen-2-ylmethanone.
| Compound Name | [10-(thiophene-2-carbonyl)-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 102424318 |
| Molecular Formula | C18H8O2S5 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 415.91 |
| IUPAC Name | [10-(thiophene-2-carbonyl)-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)c1cc2sc3cc(C(=O)c4cccs4)sc3c2s1 |
| InChI | InChI=1S/C18H8O2S5/c19-15(9-3-1-5-21-9)11-7-13-17(24-11)18-14(23-13)8-12(25-18)16(20)10-4-2-6-22-10/h1-8H |
| InChIKey | KXNRWZXUMBZGHM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |